C12H20F3NO — CID 139316363
N-(4-butylcyclohexyl)-2,2,2-trifluoroacetamide (PubChem CID 139316363) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(4-butylcyclohexyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-butylcyclohexyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 139316363 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(4-butylcyclohexyl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCC1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3NO/c1-2-3-4-9-5-7-10(8-6-9)16-11(17)12(13,14)15/h9-10H,2-8H2,1H3,(H,16,17) |
| InChIKey | KLISPFZKPOUOTP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |