C10H14F3NO2 — CID 123997637
2,2,2-trifluoro-N-(6-hydroxycyclooct-4-en-1-yl)acetamide (PubChem CID 123997637) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6-hydroxycyclooct-4-en-1-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6-hydroxycyclooct-4-en-1-yl)acetamide |
|---|---|
| PubChem CID | 123997637 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,2,2-trifluoro-N-(6-hydroxycyclooct-4-en-1-yl)acetamide |
| SMILES | O=C(NC1CCC=CC(O)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)9(16)14-7-3-1-2-4-8(15)6-5-7/h2,4,7-8,15H,1,3,5-6H2,(H,14,16) |
| InChIKey | GQGKLOPDJSHBLY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|