C7H7F3N2O — CID 166666239
N-(3-cyanocyclobutyl)-2,2,2-trifluoroacetamide (PubChem CID 166666239) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is N-(3-cyanocyclobutyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-cyanocyclobutyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 166666239 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-(3-cyanocyclobutyl)-2,2,2-trifluoroacetamide |
| SMILES | N#CC1CC(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)6(13)12-5-1-4(2-5)3-11/h4-5H,1-2H2,(H,12,13) |
| InChIKey | OIEDUXODDRTOCR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |