C11H16F3NO — CID 125180957
N-[(3aS,5R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 125180957) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[(3aS,5R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aS,5R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 125180957 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(3aS,5R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H]1CC[C@H]2CCC[C@H]2C1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)10(16)15-9-5-4-7-2-1-3-8(7)6-9/h7-9H,1-6H2,(H,15,16)/t7-,8+,9-/m1/s1 |
| InChIKey | KAJFARIPSYDZKV-HRDYMLBCSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |