C8H11ClF3NO2 — CID 13002967
N-[(4S,6S)-2-chloro-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 13002967) has the molecular formula C8H11ClF3NO2 and a molecular weight of 245.63 g/mol. Its IUPAC name is N-[(4S,6S)-2-chloro-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4S,6S)-2-chloro-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 13002967 |
| Molecular Formula | C8H11ClF3NO2 |
| Molecular Weight | 245.63 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-[(4S,6S)-2-chloro-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H]1C[C@H](NC(=O)C(F)(F)F)CC(Cl)O1 |
| InChI | InChI=1S/C8H11ClF3NO2/c1-4-2-5(3-6(9)15-4)13-7(14)8(10,11)12/h4-6H,2-3H2,1H3,(H,13,14)/t4-,5-,6?/m0/s1 |
| InChIKey | HOUUBZDEBZQOQC-HVYQYDHPSA-N |
| XLogP | 1.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|