C10H15ClF3NO3 — CID 88767486
N-[(2S,3R,4S)-6-chloro-3-methoxy-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88767486) has the molecular formula C10H15ClF3NO3 and a molecular weight of 289.68 g/mol. Its IUPAC name is N-[(2S,3R,4S)-6-chloro-3-methoxy-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4S)-6-chloro-3-methoxy-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88767486 |
| Molecular Formula | C10H15ClF3NO3 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[(2S,3R,4S)-6-chloro-3-methoxy-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CO[C@]1(C)[C@@H](NC(=O)C(F)(F)F)CC(Cl)O[C@H]1C |
| InChI | InChI=1S/C10H15ClF3NO3/c1-5-9(2,17-3)6(4-7(11)18-5)15-8(16)10(12,13)14/h5-7H,4H2,1-3H3,(H,15,16)/t5-,6-,7?,9-/m0/s1 |
| InChIKey | MMYSXNIEBWBLAQ-GOXMAWJSSA-N |
| XLogP | 1.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|