C10H16F3NO4 — CID 88768393
2,2,2-trifluoro-N-[(2S,3S,4S,6R)-6-hydroxy-3-methoxy-2,3-dimethyloxan-4-yl]acetamide (PubChem CID 88768393) has the molecular formula C10H16F3NO4 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3S,4S,6R)-6-hydroxy-3-methoxy-2,3-dimethyloxan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3S,4S,6R)-6-hydroxy-3-methoxy-2,3-dimethyloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 88768393 |
| Molecular Formula | C10H16F3NO4 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3S,4S,6R)-6-hydroxy-3-methoxy-2,3-dimethyloxan-4-yl]acetamide |
| SMILES | CO[C@@]1(C)[C@@H](NC(=O)C(F)(F)F)C[C@H](O)O[C@H]1C |
| InChI | InChI=1S/C10H16F3NO4/c1-5-9(2,17-3)6(4-7(15)18-5)14-8(16)10(11,12)13/h5-7,15H,4H2,1-3H3,(H,14,16)/t5-,6-,7+,9+/m0/s1 |
| InChIKey | HFKKCFCXFASVPD-XZMZPDFPSA-N |
| XLogP | 0.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |