C15H20F3NO3 — CID 2835991
methyl 2-(1-adamantyl)-2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 2835991) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 2-(1-adamantyl)-2-[(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | methyl 2-(1-adamantyl)-2-[(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 2835991 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl 2-(1-adamantyl)-2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20F3NO3/c1-22-12(20)11(19-13(21)15(16,17)18)14-5-8-2-9(6-14)4-10(3-8)7-14/h8-11H,2-7H2,1H3,(H,19,21) |
| InChIKey | JIXLEAUFXZCQTF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |