C17H28N2O3 — CID 7233068
methyl (2R)-2-(1-adamantyl)-2-(propan-2-ylcarbamoylamino)acetate (PubChem CID 7233068) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is methyl (2R)-2-(1-adamantyl)-2-(propan-2-ylcarbamoylamino)acetate.
| Compound Name | methyl (2R)-2-(1-adamantyl)-2-(propan-2-ylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 7233068 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | methyl (2R)-2-(1-adamantyl)-2-(propan-2-ylcarbamoylamino)acetate |
| SMILES | COC(=O)[C@H](NC(=O)NC(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H28N2O3/c1-10(2)18-16(21)19-14(15(20)22-3)17-7-11-4-12(8-17)6-13(5-11)9-17/h10-14H,4-9H2,1-3H3,(H2,18,19,21)/t11?,12?,13?,14-,17?/m0/s1 |
| InChIKey | OITRQHSFEDAPSE-ZZTKBFGJSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |