C21H27NO3 — CID 7079957
methyl (2S)-2-(1-adamantyl)-2-[(4-methylbenzoyl)amino]acetate (PubChem CID 7079957) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (2S)-2-(1-adamantyl)-2-[(4-methylbenzoyl)amino]acetate.
| Compound Name | methyl (2S)-2-(1-adamantyl)-2-[(4-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7079957 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (2S)-2-(1-adamantyl)-2-[(4-methylbenzoyl)amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27NO3/c1-13-3-5-17(6-4-13)19(23)22-18(20(24)25-2)21-10-14-7-15(11-21)9-16(8-14)12-21/h3-6,14-16,18H,7-12H2,1-2H3,(H,22,23)/t14?,15?,16?,18-,21?/m1/s1 |
| InChIKey | HYDKQMQUYFELJY-DIKOGFFKSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |