C10H15F3INO2 — CID 132568112
2,2,2-trifluoro-N-[(3R,4S)-4-iodo-2,2,5,5-tetramethyloxolan-3-yl]acetamide (PubChem CID 132568112) has the molecular formula C10H15F3INO2 and a molecular weight of 365.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3R,4S)-4-iodo-2,2,5,5-tetramethyloxolan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3R,4S)-4-iodo-2,2,5,5-tetramethyloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 132568112 |
| Molecular Formula | C10H15F3INO2 |
| Molecular Weight | 365.13 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3R,4S)-4-iodo-2,2,5,5-tetramethyloxolan-3-yl]acetamide |
| SMILES | CC1(C)OC(C)(C)[C@@H](NC(=O)C(F)(F)F)[C@@H]1I |
| InChI | InChI=1S/C10H15F3INO2/c1-8(2)5(14)6(9(3,4)17-8)15-7(16)10(11,12)13/h5-6H,1-4H3,(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | DGVNQNIOXGTPOI-WDSKDSINSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|