C13H19F6N3O2 — CID 1114902
2,2,2-trifluoro-N-[(3S,4R)-2,2,6,6-tetramethyl-3-[(2,2,2-trifluoroacetyl)amino]piperidin-4-yl]acetamide (PubChem CID 1114902) has the molecular formula C13H19F6N3O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4R)-2,2,6,6-tetramethyl-3-[(2,2,2-trifluoroacetyl)amino]piperidin-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4R)-2,2,6,6-tetramethyl-3-[(2,2,2-trifluoroacetyl)amino]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 1114902 |
| Molecular Formula | C13H19F6N3O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4R)-2,2,6,6-tetramethyl-3-[(2,2,2-trifluoroacetyl)amino]piperidin-4-yl]acetamide |
| SMILES | CC1(C)C[C@@H](NC(=O)C(F)(F)F)[C@H](NC(=O)C(F)(F)F)C(C)(C)N1 |
| InChI | InChI=1S/C13H19F6N3O2/c1-10(2)5-6(20-8(23)12(14,15)16)7(11(3,4)22-10)21-9(24)13(17,18)19/h6-7,22H,5H2,1-4H3,(H,20,23)(H,21,24)/t6-,7+/m1/s1 |
| InChIKey | CENWDAKHRRVLAG-RQJHMYQMSA-N |
| XLogP | 1.63 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |