C18H32F3NO4 — CID 88719743
N-[(2S,4S,5R,6R)-2,5-dihydroxy-6-methyl-2,5-dipentyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88719743) has the molecular formula C18H32F3NO4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(2S,4S,5R,6R)-2,5-dihydroxy-6-methyl-2,5-dipentyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,4S,5R,6R)-2,5-dihydroxy-6-methyl-2,5-dipentyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88719743 |
| Molecular Formula | C18H32F3NO4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-[(2S,4S,5R,6R)-2,5-dihydroxy-6-methyl-2,5-dipentyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCC[C@@]1(O)C[C@H](NC(=O)C(F)(F)F)[C@](O)(CCCCC)[C@@H](C)O1 |
| InChI | InChI=1S/C18H32F3NO4/c1-4-6-8-10-16(24)12-14(22-15(23)18(19,20)21)17(25,13(3)26-16)11-9-7-5-2/h13-14,24-25H,4-12H2,1-3H3,(H,22,23)/t13-,14+,16+,17+/m1/s1 |
| InChIKey | AQBXUUYEFSVVOB-OHFALNGGSA-N |
| XLogP | 3.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|