C16H22ClNO6 — CID 102252786
ethyl (2R,3R)-3-chloro-4-ethoxy-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 102252786) has the molecular formula C16H22ClNO6 and a molecular weight of 359.81 g/mol. Its IUPAC name is ethyl (2R,3R)-3-chloro-4-ethoxy-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | ethyl (2R,3R)-3-chloro-4-ethoxy-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 102252786 |
| Molecular Formula | C16H22ClNO6 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl (2R,3R)-3-chloro-4-ethoxy-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@@H](Cl)C(NC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C16H22ClNO6/c1-3-22-14(12(17)13(19)15(20)23-4-2)18-16(21)24-10-11-8-6-5-7-9-11/h5-9,12-14,19H,3-4,10H2,1-2H3,(H,18,21)/t12-,13+,14?/m1/s1 |
| InChIKey | USOPQAPLJAKWBT-AMIUJLCOSA-N |
| XLogP | 1.81 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|