C29H41N5O8 — CID 90712690
benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 90712690) has the molecular formula C29H41N5O8 and a molecular weight of 587.67 g/mol. Its IUPAC name is benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90712690 |
| Molecular Formula | C29H41N5O8 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCOC(CN(C(=O)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)C(CN)NC(=O)OCc1ccccc1)C(C)C)OCC |
| InChI | InChI=1S/C29H41N5O8/c1-5-40-26(41-6-2)18-33(20(3)4)28(36)24(16-21-12-14-23(15-13-21)34(38)39)31-27(35)25(17-30)32-29(37)42-19-22-10-8-7-9-11-22/h7-15,20,24-26H,5-6,16-19,30H2,1-4H3,(H,31,35)(H,32,37) |
| InChIKey | RITDSYMDEUURNE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 175.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|