C33H39N3O7 — CID 68695225
[1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid (PubChem CID 68695225) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is [1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid.
| Compound Name | [1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 68695225 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | [1-[2,2-diethoxyethyl(propan-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid |
| SMILES | CCOC(CN(C(=O)C(Cc1ccc([N+](=O)[O-])cc1)N(CC1c2ccccc2-c2ccccc21)C(=O)O)C(C)C)OCC |
| InChI | InChI=1S/C33H39N3O7/c1-5-42-31(43-6-2)21-34(22(3)4)32(37)30(19-23-15-17-24(18-16-23)36(40)41)35(33(38)39)20-29-27-13-9-7-11-25(27)26-12-8-10-14-28(26)29/h7-18,22,29-31H,5-6,19-21H2,1-4H3,(H,38,39) |
| InChIKey | SWKFIVYJQVELAI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|