C22H33ClN2O5 — CID 67339533
[3-(4-chlorophenyl)-1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxopropan-2-yl]-prop-2-enylcarbamic acid (PubChem CID 67339533) has the molecular formula C22H33ClN2O5 and a molecular weight of 440.97 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxopropan-2-yl]-prop-2-enylcarbamic acid.
| Compound Name | [3-(4-chlorophenyl)-1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxopropan-2-yl]-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 67339533 |
| Molecular Formula | C22H33ClN2O5 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [3-(4-chlorophenyl)-1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxopropan-2-yl]-prop-2-enylcarbamic acid |
| SMILES | C=CCN(C(=O)O)C(Cc1ccc(Cl)cc1)C(=O)N(CC(OCC)OCC)C(C)C |
| InChI | InChI=1S/C22H33ClN2O5/c1-6-13-24(22(27)28)19(14-17-9-11-18(23)12-10-17)21(26)25(16(4)5)15-20(29-7-2)30-8-3/h6,9-12,16,19-20H,1,7-8,13-15H2,2-5H3,(H,27,28) |
| InChIKey | YRNBIKQVAJYZSR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|