C17H27ClN2O3 — CID 67340778
2-amino-3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-N-ethylpropanamide (PubChem CID 67340778) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-amino-3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-N-ethylpropanamide.
| Compound Name | 2-amino-3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 67340778 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-amino-3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-N-ethylpropanamide |
| SMILES | CCOC(CN(CC)C(=O)C(N)Cc1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C17H27ClN2O3/c1-4-20(12-16(22-5-2)23-6-3)17(21)15(19)11-13-7-9-14(18)10-8-13/h7-10,15-16H,4-6,11-12,19H2,1-3H3 |
| InChIKey | CCMQQCWSANCNNU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|