C29H37F5N4O6 — CID 90933612
benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 90933612) has the molecular formula C29H37F5N4O6 and a molecular weight of 632.63 g/mol. Its IUPAC name is benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90933612 |
| Molecular Formula | C29H37F5N4O6 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | benzyl N-[3-amino-1-[[1-[2,2-diethoxyethyl(propan-2-yl)amino]-1-oxo-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCOC(CN(C(=O)C(Cc1c(F)c(F)c(F)c(F)c1F)NC(=O)C(CN)NC(=O)OCc1ccccc1)C(C)C)OCC |
| InChI | InChI=1S/C29H37F5N4O6/c1-5-42-21(43-6-2)14-38(16(3)4)28(40)19(12-18-22(30)24(32)26(34)25(33)23(18)31)36-27(39)20(13-35)37-29(41)44-15-17-10-8-7-9-11-17/h7-11,16,19-21H,5-6,12-15,35H2,1-4H3,(H,36,39)(H,37,41) |
| InChIKey | XKFQJFJWDFLNCV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|