C26H22N4O10 — CID 10864566
[(2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl] 3,5-dinitrobenzoate (PubChem CID 10864566) has the molecular formula C26H22N4O10 and a molecular weight of 550.48 g/mol. Its IUPAC name is [(2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl] 3,5-dinitrobenzoate.
| Compound Name | [(2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 10864566 |
| Molecular Formula | C26H22N4O10 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [(2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl] 3,5-dinitrobenzoate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)N[C@@H](Cc1ccccc1)C(=O)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N4O10/c31-23(15-27-26(34)39-16-18-9-5-2-6-10-18)28-22(11-17-7-3-1-4-8-17)25(33)40-24(32)19-12-20(29(35)36)14-21(13-19)30(37)38/h1-10,12-14,22H,11,15-16H2,(H,27,34)(H,28,31)/t22-/m0/s1 |
| InChIKey | IZWFCGCJPLDBHM-QFIPXVFZSA-N |
| XLogP | 2.84 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|