C15H20N4O7 — CID 118902359
(3,5-dinitrophenyl)methyl (2S)-2-acetamido-6-aminohexanoate (PubChem CID 118902359) has the molecular formula C15H20N4O7 and a molecular weight of 368.35 g/mol. Its IUPAC name is (3,5-dinitrophenyl)methyl (2S)-2-acetamido-6-aminohexanoate.
| Compound Name | (3,5-dinitrophenyl)methyl (2S)-2-acetamido-6-aminohexanoate |
|---|---|
| PubChem CID | 118902359 |
| Molecular Formula | C15H20N4O7 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (3,5-dinitrophenyl)methyl (2S)-2-acetamido-6-aminohexanoate |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N4O7/c1-10(20)17-14(4-2-3-5-16)15(21)26-9-11-6-12(18(22)23)8-13(7-11)19(24)25/h6-8,14H,2-5,9,16H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | FTIWSRSSYGCZDK-AWEZNQCLSA-N |
| XLogP | 1.18 |
| TPSA | 167.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|