C8H5ClN2O5 — CID 21455466
2-(3,5-dinitrophenyl)acetyl chloride (PubChem CID 21455466) has the molecular formula C8H5ClN2O5 and a molecular weight of 244.59 g/mol. Its IUPAC name is 2-(3,5-dinitrophenyl)acetyl chloride.
| Compound Name | 2-(3,5-dinitrophenyl)acetyl chloride |
|---|---|
| PubChem CID | 21455466 |
| Molecular Formula | C8H5ClN2O5 |
| Molecular Weight | 244.59 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 2-(3,5-dinitrophenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H5ClN2O5/c9-8(12)3-5-1-6(10(13)14)4-7(2-5)11(15)16/h1-2,4H,3H2 |
| InChIKey | VBOZFGKQYUPJLJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|