C9H7N5O4 — CID 102593384
1-[(3,5-dinitrophenyl)methyl]triazole (PubChem CID 102593384) has the molecular formula C9H7N5O4 and a molecular weight of 249.19 g/mol. Its IUPAC name is 1-[(3,5-dinitrophenyl)methyl]triazole.
| Compound Name | 1-[(3,5-dinitrophenyl)methyl]triazole |
|---|---|
| PubChem CID | 102593384 |
| Molecular Formula | C9H7N5O4 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 1-[(3,5-dinitrophenyl)methyl]triazole |
| SMILES | O=[N+]([O-])c1cc(Cn2ccnn2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7N5O4/c15-13(16)8-3-7(4-9(5-8)14(17)18)6-12-2-1-10-11-12/h1-5H,6H2 |
| InChIKey | HSTOFEXMCYJDFX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|