C10H9N5O5 — CID 102593386
1-[(4-methoxy-3,5-dinitrophenyl)methyl]triazole (PubChem CID 102593386) has the molecular formula C10H9N5O5 and a molecular weight of 279.21 g/mol. Its IUPAC name is 1-[(4-methoxy-3,5-dinitrophenyl)methyl]triazole.
| Compound Name | 1-[(4-methoxy-3,5-dinitrophenyl)methyl]triazole |
|---|---|
| PubChem CID | 102593386 |
| Molecular Formula | C10H9N5O5 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-[(4-methoxy-3,5-dinitrophenyl)methyl]triazole |
| SMILES | COc1c([N+](=O)[O-])cc(Cn2ccnn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N5O5/c1-20-10-8(14(16)17)4-7(5-9(10)15(18)19)6-13-3-2-11-12-13/h2-5H,6H2,1H3 |
| InChIKey | YIEWRGFELMNVSX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 126.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|