C12H7N5O10 — CID 125115055
1-(4-methoxy-3,5-dinitrophenyl)-3,5-dinitropyridin-4-one (PubChem CID 125115055) has the molecular formula C12H7N5O10 and a molecular weight of 381.21 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dinitrophenyl)-3,5-dinitropyridin-4-one.
| Compound Name | 1-(4-methoxy-3,5-dinitrophenyl)-3,5-dinitropyridin-4-one |
|---|---|
| PubChem CID | 125115055 |
| Molecular Formula | C12H7N5O10 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 1-(4-methoxy-3,5-dinitrophenyl)-3,5-dinitropyridin-4-one |
| SMILES | COc1c([N+](=O)[O-])cc(-n2cc([N+](=O)[O-])c(=O)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7N5O10/c1-27-12-7(14(19)20)2-6(3-8(12)15(21)22)13-4-9(16(23)24)11(18)10(5-13)17(25)26/h2-5H,1H3 |
| InChIKey | ZYGBREUSODHDCF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 203.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|