C15H20N2O6S — CID 101484747
2-methylhept-6-en-3-yl N-(4-nitrophenyl)sulfonylcarbamate (PubChem CID 101484747) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-methylhept-6-en-3-yl N-(4-nitrophenyl)sulfonylcarbamate.
| Compound Name | 2-methylhept-6-en-3-yl N-(4-nitrophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 101484747 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-methylhept-6-en-3-yl N-(4-nitrophenyl)sulfonylcarbamate |
| SMILES | C=CCCC(OC(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C15H20N2O6S/c1-4-5-6-14(11(2)3)23-15(18)16-24(21,22)13-9-7-12(8-10-13)17(19)20/h4,7-11,14H,1,5-6H2,2-3H3,(H,16,18) |
| InChIKey | PGWFIIAQGVWOMG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|