C14H18N2O6S — CID 101484755
hept-1-en-4-yl N-(4-nitrophenyl)sulfonylcarbamate (PubChem CID 101484755) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is hept-1-en-4-yl N-(4-nitrophenyl)sulfonylcarbamate.
| Compound Name | hept-1-en-4-yl N-(4-nitrophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 101484755 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | hept-1-en-4-yl N-(4-nitrophenyl)sulfonylcarbamate |
| SMILES | C=CCC(CCC)OC(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O6S/c1-3-5-12(6-4-2)22-14(17)15-23(20,21)13-9-7-11(8-10-13)16(18)19/h3,7-10,12H,1,4-6H2,2H3,(H,15,17) |
| InChIKey | CKVLIMBUPQLTFR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|