C19H19Cl3N2O4S — CID 57337474
[(E)-4-(2-hydroxy-N-(4-methylphenyl)sulfonylanilino)but-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 57337474) has the molecular formula C19H19Cl3N2O4S and a molecular weight of 477.80 g/mol. Its IUPAC name is [(E)-4-(2-hydroxy-N-(4-methylphenyl)sulfonylanilino)but-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-4-(2-hydroxy-N-(4-methylphenyl)sulfonylanilino)but-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 57337474 |
| Molecular Formula | C19H19Cl3N2O4S |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | [(E)-4-(2-hydroxy-N-(4-methylphenyl)sulfonylanilino)but-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/CN(c1ccccc1O)S(=O)(=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H19Cl3N2O4S/c1-14-8-10-15(11-9-14)29(26,27)24(16-6-2-3-7-17(16)25)12-4-5-13-28-18(23)19(20,21)22/h2-11,23,25H,12-13H2,1H3/b5-4+,23-18+ |
| InChIKey | UMAPJFCRXBBIPJ-RNYRAKKWSA-N |
| XLogP | 4.82 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|