C21H25NO6S — CID 101095662
[(Z)-4-(2-hydroxy-N-(2,4,6-trimethylphenyl)sulfonylanilino)but-2-enyl] methyl carbonate (PubChem CID 101095662) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [(Z)-4-(2-hydroxy-N-(2,4,6-trimethylphenyl)sulfonylanilino)but-2-enyl] methyl carbonate.
| Compound Name | [(Z)-4-(2-hydroxy-N-(2,4,6-trimethylphenyl)sulfonylanilino)but-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 101095662 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(Z)-4-(2-hydroxy-N-(2,4,6-trimethylphenyl)sulfonylanilino)but-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C\CN(c1ccccc1O)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H25NO6S/c1-15-13-16(2)20(17(3)14-15)29(25,26)22(18-9-5-6-10-19(18)23)11-7-8-12-28-21(24)27-4/h5-10,13-14,23H,11-12H2,1-4H3/b8-7- |
| InChIKey | WGYHKVMYAPVKGC-FPLPWBNLSA-N |
| XLogP | 3.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|