C13H17NO4S — CID 135038237
N-(2,3-dihydroxypropyl)-4-methyl-N-prop-2-ynylbenzenesulfonamide (PubChem CID 135038237) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4-methyl-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(2,3-dihydroxypropyl)-4-methyl-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 135038237 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4-methyl-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC(O)CO)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO4S/c1-3-8-14(9-12(16)10-15)19(17,18)13-6-4-11(2)5-7-13/h1,4-7,12,15-16H,8-10H2,2H3 |
| InChIKey | HXCYPJCQJRSWDP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|