C27H28N2O4S2 — CID 101451188
4-methyl-N-[(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-2-bicyclo[2.2.1]hept-5-enyl]-N-prop-2-ynylbenzenesulfonamide (PubChem CID 101451188) has the molecular formula C27H28N2O4S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 4-methyl-N-[(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-2-bicyclo[2.2.1]hept-5-enyl]-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-2-bicyclo[2.2.1]hept-5-enyl]-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 101451188 |
| Molecular Formula | C27H28N2O4S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 4-methyl-N-[(1S,2R,3S,4R)-3-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-2-bicyclo[2.2.1]hept-5-enyl]-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN([C@@H]1[C@H](N(CC#C)S(=O)(=O)c2ccc(C)cc2)[C@@H]2C=C[C@H]1C2)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H28N2O4S2/c1-5-17-28(34(30,31)24-13-7-20(3)8-14-24)26-22-11-12-23(19-22)27(26)29(18-6-2)35(32,33)25-15-9-21(4)10-16-25/h1-2,7-16,22-23,26-27H,17-19H2,3-4H3/t22-,23+,26-,27+ |
| InChIKey | FAQSXXKZYLMUNX-XOMBCNSKSA-N |
| XLogP | 3.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|