C23H33NO2S — CID 46862062
N-but-2-ynyl-N-[(2,3-dibutylcycloprop-2-en-1-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 46862062) has the molecular formula C23H33NO2S and a molecular weight of 387.59 g/mol. Its IUPAC name is N-but-2-ynyl-N-[(2,3-dibutylcycloprop-2-en-1-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-but-2-ynyl-N-[(2,3-dibutylcycloprop-2-en-1-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46862062 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-but-2-ynyl-N-[(2,3-dibutylcycloprop-2-en-1-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | CC#CCN(CC1C(CCCC)=C1CCCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H33NO2S/c1-5-8-11-21-22(12-9-6-2)23(21)18-24(17-10-7-3)27(25,26)20-15-13-19(4)14-16-20/h13-16,23H,5-6,8-9,11-12,17-18H2,1-4H3 |
| InChIKey | FBQZPNXCNKIORS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|