C19H21NO4S — CID 134969151
N-but-2-ynyl-N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 134969151) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-but-2-ynyl-N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-but-2-ynyl-N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134969151 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-but-2-ynyl-N-(3,5-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | CC#CCN(c1cc(OC)cc(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-5-6-11-20(16-12-17(23-3)14-18(13-16)24-4)25(21,22)19-9-7-15(2)8-10-19/h7-10,12-14H,11H2,1-4H3 |
| InChIKey | XKOIUZHCNGMPSW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|