C24H25NO5S — CID 19211422
N-(4-ethylphenyl)-3,5-dimethoxy-N-(4-methylphenyl)sulfonylbenzamide (PubChem CID 19211422) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3,5-dimethoxy-N-(4-methylphenyl)sulfonylbenzamide.
| Compound Name | N-(4-ethylphenyl)-3,5-dimethoxy-N-(4-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19211422 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-(4-ethylphenyl)-3,5-dimethoxy-N-(4-methylphenyl)sulfonylbenzamide |
| SMILES | CCc1ccc(N(C(=O)c2cc(OC)cc(OC)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-5-18-8-10-20(11-9-18)25(31(27,28)23-12-6-17(2)7-13-23)24(26)19-14-21(29-3)16-22(15-19)30-4/h6-16H,5H2,1-4H3 |
| InChIKey | DPYNRJCSPIXZHT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |