C15H23N3O2S2 — CID 71851155
1-butan-2-yl-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)imidazole-4-sulfonamide (PubChem CID 71851155) has the molecular formula C15H23N3O2S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-butan-2-yl-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)imidazole-4-sulfonamide.
| Compound Name | 1-butan-2-yl-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 71851155 |
| Molecular Formula | C15H23N3O2S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-butan-2-yl-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)imidazole-4-sulfonamide |
| SMILES | CCC(C)n1cnc(S(=O)(=O)N(C)C(C)Cc2cccs2)c1 |
| InChI | InChI=1S/C15H23N3O2S2/c1-5-12(2)18-10-15(16-11-18)22(19,20)17(4)13(3)9-14-7-6-8-21-14/h6-8,10-13H,5,9H2,1-4H3 |
| InChIKey | DQAGFGOKVIPBHZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |