C13H21NO4S2 — CID 61460631
methyl 4-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]butanoate (PubChem CID 61460631) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is methyl 4-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460631 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl 4-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N(Cc1cccs1)C(C)C |
| InChI | InChI=1S/C13H21NO4S2/c1-11(2)14(10-12-6-4-8-19-12)20(16,17)9-5-7-13(15)18-3/h4,6,8,11H,5,7,9-10H2,1-3H3 |
| InChIKey | ZICAJDMMOQGSQU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |