C17H23NO3S2 — CID 142642973
N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-3-thiophen-2-ylpropane-1-sulfonamide (PubChem CID 142642973) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-3-thiophen-2-ylpropane-1-sulfonamide.
| Compound Name | N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-3-thiophen-2-ylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 142642973 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-benzyl-N-[(2R)-1-hydroxypropan-2-yl]-3-thiophen-2-ylpropane-1-sulfonamide |
| SMILES | C[C@H](CO)N(Cc1ccccc1)S(=O)(=O)CCCc1cccs1 |
| InChI | InChI=1S/C17H23NO3S2/c1-15(14-19)18(13-16-7-3-2-4-8-16)23(20,21)12-6-10-17-9-5-11-22-17/h2-5,7-9,11,15,19H,6,10,12-14H2,1H3/t15-/m1/s1 |
| InChIKey | FXBPVGFLPSPZTO-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |