C14H17NO2S2 — CID 110779514
3-phenyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide (PubChem CID 110779514) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-phenyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-phenyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 110779514 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-phenyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCc1ccccc1)NCc1cccs1 |
| InChI | InChI=1S/C14H17NO2S2/c16-19(17,15-12-14-9-4-10-18-14)11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,15H,5,8,11-12H2 |
| InChIKey | GPEYQFMTBWBWKN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |