C17H24N2O2S2 — CID 112503232
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-phenylpropane-1-sulfonamide (PubChem CID 112503232) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-phenylpropane-1-sulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 112503232 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-phenylpropane-1-sulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)CCCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C17H24N2O2S2/c1-19(2)16(17-11-6-12-22-17)14-18-23(20,21)13-7-10-15-8-4-3-5-9-15/h3-6,8-9,11-12,16,18H,7,10,13-14H2,1-2H3 |
| InChIKey | KHOJZVMZQDYAGX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |