About 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide
3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide (PubChem CID 110717616) has the molecular formula C14H18N2O2S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide |
| PubChem CID | 110717616 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCc1ccccc1)NCCc1cncs1 |
| InChI | InChI=1S/C14H18N2O2S2/c17-20(18,16-9-8-14-11-15-12-19-14)10-4-7-13-5-2-1-3-6-13/h1-3,5-6,11-12,16H,4,7-10H2 |
| InChIKey | HQXSWGRSEMQDQO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide?
The IUPAC name of 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide (CID 110717616) is 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide.
What is the SMILES notation for 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide?
The canonical SMILES for 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide is O=S(=O)(CCCc1ccccc1)NCCc1cncs1.
What is the InChIKey of 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide?
The InChIKey is HQXSWGRSEMQDQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S2/c17-20(18,16-9-8-14-11-15-12-19-14)10-4-7-13-5-2-1-3-6-13/h1-3,5-6,11-12,16H,4,7-10H2.
What are the key properties of 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide?
3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide has a molecular weight of 310.44 g/mol, XLogP of 2.24, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-N-[2-(1,3-thiazol-5-yl)ethyl]propane-1-sulfonamide is sourced from PubChem (CID 110717616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).