C14H18ClNO2S3 — CID 116815238
4-chloro-N,N-bis(thiophen-2-ylmethyl)butane-1-sulfonamide (PubChem CID 116815238) has the molecular formula C14H18ClNO2S3 and a molecular weight of 363.96 g/mol. Its IUPAC name is 4-chloro-N,N-bis(thiophen-2-ylmethyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N,N-bis(thiophen-2-ylmethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815238 |
| Molecular Formula | C14H18ClNO2S3 |
| Molecular Weight | 363.96 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-chloro-N,N-bis(thiophen-2-ylmethyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C14H18ClNO2S3/c15-7-1-2-10-21(17,18)16(11-13-5-3-8-19-13)12-14-6-4-9-20-14/h3-6,8-9H,1-2,7,10-12H2 |
| InChIKey | JOODIGFIDKICBQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|