C22H24N2O4S6 — CID 118620774
N-[3-[bis(thiophen-2-ylmethyl)sulfamoyl]propyl]-3-(thiophen-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 118620774) has the molecular formula C22H24N2O4S6 and a molecular weight of 572.85 g/mol. Its IUPAC name is N-[3-[bis(thiophen-2-ylmethyl)sulfamoyl]propyl]-3-(thiophen-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[3-[bis(thiophen-2-ylmethyl)sulfamoyl]propyl]-3-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 118620774 |
| Molecular Formula | C22H24N2O4S6 |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | N-[3-[bis(thiophen-2-ylmethyl)sulfamoyl]propyl]-3-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCS(=O)(=O)N(Cc1cccs1)Cc1cccs1)c1sccc1Cc1cccs1 |
| InChI | InChI=1S/C22H24N2O4S6/c25-33(26,24(16-20-6-2-11-30-20)17-21-7-3-12-31-21)14-4-9-23-34(27,28)22-18(8-13-32-22)15-19-5-1-10-29-19/h1-3,5-8,10-13,23H,4,9,14-17H2 |
| InChIKey | ZAQMQZLIKTWPSZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|