C15H24N4O2S2 — CID 120973103
1-(cyclobutylmethyl)-2-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 120973103) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120973103 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | N/C(=N\CC1CCN(S(=O)(=O)c2cccs2)C1)NCC1CCC1 |
| InChI | InChI=1S/C15H24N4O2S2/c16-15(17-9-12-3-1-4-12)18-10-13-6-7-19(11-13)23(20,21)14-5-2-8-22-14/h2,5,8,12-13H,1,3-4,6-7,9-11H2,(H3,16,17,18) |
| InChIKey | KDDHCWGJTSAZFH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|