C16H23N3O3S — CID 146211753
N-[[1-[4-(dimethylamino)benzoyl]pyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211753) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[[1-[4-(dimethylamino)benzoyl]pyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[1-[4-(dimethylamino)benzoyl]pyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211753 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[[1-[4-(dimethylamino)benzoyl]pyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCC1CCN(C(=O)c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C16H23N3O3S/c1-4-23(21,22)17-11-13-9-10-19(12-13)16(20)14-5-7-15(8-6-14)18(2)3/h4-8,13,17H,1,9-12H2,2-3H3 |
| InChIKey | SFWJWYPBNHYLFB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |