C14H16F2N2O3S — CID 146211417
N-[[(3S)-1-(3,5-difluorobenzoyl)pyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211417) has the molecular formula C14H16F2N2O3S and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[[(3S)-1-(3,5-difluorobenzoyl)pyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3S)-1-(3,5-difluorobenzoyl)pyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211417 |
| Molecular Formula | C14H16F2N2O3S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[[(3S)-1-(3,5-difluorobenzoyl)pyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCN(C(=O)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C14H16F2N2O3S/c1-2-22(20,21)17-8-10-3-4-18(9-10)14(19)11-5-12(15)7-13(16)6-11/h2,5-7,10,17H,1,3-4,8-9H2/t10-/m1/s1 |
| InChIKey | ABVGVVAMYPRUIF-SNVBAGLBSA-N |
| XLogP | 1.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |