C19H24F3N3O2 — CID 121153923
1-[1-[3-[4-(trifluoromethyl)phenyl]propanoyl]azetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121153923) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[1-[3-[4-(trifluoromethyl)phenyl]propanoyl]azetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[3-[4-(trifluoromethyl)phenyl]propanoyl]azetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121153923 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[1-[3-[4-(trifluoromethyl)phenyl]propanoyl]azetidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CN(C(=O)CCc3ccc(C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C19H24F3N3O2/c20-19(21,22)15-4-1-13(2-5-15)3-6-17(26)25-11-16(12-25)24-9-7-14(8-10-24)18(23)27/h1-2,4-5,14,16H,3,6-12H2,(H2,23,27) |
| InChIKey | DANSVTMDFRVEGD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |