C15H22N2O4S — CID 136588996
(2S)-4-(4-butan-2-ylphenyl)sulfonylpiperazine-2-carboxylic acid (PubChem CID 136588996) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S)-4-(4-butan-2-ylphenyl)sulfonylpiperazine-2-carboxylic acid.
| Compound Name | (2S)-4-(4-butan-2-ylphenyl)sulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 136588996 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2S)-4-(4-butan-2-ylphenyl)sulfonylpiperazine-2-carboxylic acid |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-3-11(2)12-4-6-13(7-5-12)22(20,21)17-9-8-16-14(10-17)15(18)19/h4-7,11,14,16H,3,8-10H2,1-2H3,(H,18,19)/t11?,14-/m0/s1 |
| InChIKey | YUBBUIQHNKZRQN-IAXJKZSUSA-N |
| XLogP | 1.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |