C23H30N4O5S2 — CID 174594643
bis[4-(4-methylphenyl)sulfonylpiperazin-2-yl]methanone (PubChem CID 174594643) has the molecular formula C23H30N4O5S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is bis[4-(4-methylphenyl)sulfonylpiperazin-2-yl]methanone.
| Compound Name | bis[4-(4-methylphenyl)sulfonylpiperazin-2-yl]methanone |
|---|---|
| PubChem CID | 174594643 |
| Molecular Formula | C23H30N4O5S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | bis[4-(4-methylphenyl)sulfonylpiperazin-2-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(C(=O)C3CN(S(=O)(=O)c4ccc(C)cc4)CCN3)C2)cc1 |
| InChI | InChI=1S/C23H30N4O5S2/c1-17-3-7-19(8-4-17)33(29,30)26-13-11-24-21(15-26)23(28)22-16-27(14-12-25-22)34(31,32)20-9-5-18(2)6-10-20/h3-10,21-22,24-25H,11-16H2,1-2H3 |
| InChIKey | ADYBGPUGEAILKK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |