C14H20N2O2S2 — CID 125180183
(4aS,8aS)-6-(4-methylphenyl)sulfonyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]thiazine (PubChem CID 125180183) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (4aS,8aS)-6-(4-methylphenyl)sulfonyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]thiazine.
| Compound Name | (4aS,8aS)-6-(4-methylphenyl)sulfonyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 125180183 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (4aS,8aS)-6-(4-methylphenyl)sulfonyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]thiazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3NCCS[C@H]3C2)cc1 |
| InChI | InChI=1S/C14H20N2O2S2/c1-11-2-4-12(5-3-11)20(17,18)16-8-6-13-14(10-16)19-9-7-15-13/h2-5,13-15H,6-10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | RDBZGGDYXYAFFO-KBPBESRZSA-N |
| XLogP | 1.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |