C13H20N2O2S — CID 82247239
5-methyl-1-(4-methylphenyl)sulfonyl-1,4-diazepane (PubChem CID 82247239) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 5-methyl-1-(4-methylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 82247239 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)sulfonyl-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(C)CC2)cc1 |
| InChI | InChI=1S/C13H20N2O2S/c1-11-3-5-13(6-4-11)18(16,17)15-9-7-12(2)14-8-10-15/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | LJNDDBRPIMSEBS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |